C17H20F3NO — CID 130242629
(2E,4E)-1-(3-ethyl-2-methoxyphenyl)-5-(trifluoromethyl)hepta-2,4,6-trien-2-amine (PubChem CID 130242629) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is (2E,4E)-1-(3-ethyl-2-methoxyphenyl)-5-(trifluoromethyl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-1-(3-ethyl-2-methoxyphenyl)-5-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 130242629 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2E,4E)-1-(3-ethyl-2-methoxyphenyl)-5-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C=C(\N)Cc1cccc(CC)c1OC)C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO/c1-4-12-7-6-8-13(16(12)22-3)11-15(21)10-9-14(5-2)17(18,19)20/h5-10H,2,4,11,21H2,1,3H3/b14-9+,15-10+ |
| InChIKey | WMQRHXYAOMNRLM-AOEKMSOUSA-N |
| XLogP | 4.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|