C19H26F2N2 — CID 130242712
(3E,5R,6E)-2-(1,2,4a,5,6,7-hexahydroquinolin-3-yl)-8,8-difluoro-5,7-dimethylocta-1,3,6-trien-3-amine (PubChem CID 130242712) has the molecular formula C19H26F2N2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3E,5R,6E)-2-(1,2,4a,5,6,7-hexahydroquinolin-3-yl)-8,8-difluoro-5,7-dimethylocta-1,3,6-trien-3-amine.
| Compound Name | (3E,5R,6E)-2-(1,2,4a,5,6,7-hexahydroquinolin-3-yl)-8,8-difluoro-5,7-dimethylocta-1,3,6-trien-3-amine |
|---|---|
| PubChem CID | 130242712 |
| Molecular Formula | C19H26F2N2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (3E,5R,6E)-2-(1,2,4a,5,6,7-hexahydroquinolin-3-yl)-8,8-difluoro-5,7-dimethylocta-1,3,6-trien-3-amine |
| SMILES | C=C(C1=CC2CCCC=C2NC1)/C(N)=C\[C@H](C)/C=C(\C)C(F)F |
| InChI | InChI=1S/C19H26F2N2/c1-12(8-13(2)19(20)21)9-17(22)14(3)16-10-15-6-4-5-7-18(15)23-11-16/h7-10,12,15,19,23H,3-6,11,22H2,1-2H3/b13-8+,17-9+/t12-,15?/m1/s1 |
| InChIKey | XSMNPXITUCGVBH-OZNOGRNISA-N |
| XLogP | 4.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|