C17H28N2 — CID 130242725
1-(3,4-dimethylpenta-1,4-dien-2-yl)-1-[(2E,4Z)-2-ethenylocta-2,4-dienyl]hydrazine (PubChem CID 130242725) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-(3,4-dimethylpenta-1,4-dien-2-yl)-1-[(2E,4Z)-2-ethenylocta-2,4-dienyl]hydrazine.
| Compound Name | 1-(3,4-dimethylpenta-1,4-dien-2-yl)-1-[(2E,4Z)-2-ethenylocta-2,4-dienyl]hydrazine |
|---|---|
| PubChem CID | 130242725 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-(3,4-dimethylpenta-1,4-dien-2-yl)-1-[(2E,4Z)-2-ethenylocta-2,4-dienyl]hydrazine |
| SMILES | C=C/C(=C\C=C/CCC)CN(N)C(=C)C(C)C(=C)C |
| InChI | InChI=1S/C17H28N2/c1-7-9-10-11-12-17(8-2)13-19(18)16(6)15(5)14(3)4/h8,10-12,15H,2-3,6-7,9,13,18H2,1,4-5H3/b11-10-,17-12+ |
| InChIKey | LNVLLJLXSAQIOR-WUSHYMHTSA-N |
| XLogP | 4.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|