About (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine
(3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine (PubChem CID 130242730) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine.
Molecular Properties
| Compound Name | (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine |
| PubChem CID | 130242730 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine |
| SMILES | [H]/N=C(C)/C(=C/C1(C)CCCN1C)C(=C)C |
| InChI | InChI=1S/C13H22N2/c1-10(2)12(11(3)14)9-13(4)7-6-8-15(13)5/h9,14H,1,6-8H2,2-5H3/b12-9+,14-11+ |
| InChIKey | YOCIIISJJMNUBS-JZAGDRGGSA-N |
| XLogP | 3.01 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine?
The IUPAC name of (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine (CID 130242730) is (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine.
What is the SMILES notation for (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine?
The canonical SMILES for (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine is [H]/N=C(C)/C(=C/C1(C)CCCN1C)C(=C)C.
What is the InChIKey of (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine?
The InChIKey is YOCIIISJJMNUBS-JZAGDRGGSA-N. The full InChI is InChI=1S/C13H22N2/c1-10(2)12(11(3)14)9-13(4)7-6-8-15(13)5/h9,14H,1,6-8H2,2-5H3/b12-9+,14-11+.
What are the key properties of (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine?
(3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine has a molecular weight of 206.33 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(1,2-dimethylpyrrolidin-2-yl)methylidene]-4-methylpent-4-en-2-imine is sourced from PubChem (CID 130242730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).