About 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine
3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine (PubChem CID 130242734) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine.
Molecular Properties
| Compound Name | 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine |
| PubChem CID | 130242734 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine |
| SMILES | C=C1NN(CC)C(C(C)(C)C)C=C1CC |
| InChI | InChI=1S/C13H24N2/c1-7-11-9-12(13(4,5)6)15(8-2)14-10(11)3/h9,12,14H,3,7-8H2,1-2,4-6H3 |
| InChIKey | VUVVWDVSWRTBAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine?
The IUPAC name of 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine (CID 130242734) is 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine.
What is the SMILES notation for 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine?
The canonical SMILES for 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine is C=C1NN(CC)C(C(C)(C)C)C=C1CC.
What is the InChIKey of 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine?
The InChIKey is VUVVWDVSWRTBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-7-11-9-12(13(4,5)6)15(8-2)14-10(11)3/h9,12,14H,3,7-8H2,1-2,4-6H3.
What are the key properties of 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine?
3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine has a molecular weight of 208.35 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,5-diethyl-6-methylidene-1,3-dihydropyridazine is sourced from PubChem (CID 130242734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).