C22H34F3N — CID 130242940
(5Z,8Z,10Z)-8-(1,3-difluoroprop-1-enyl)-6-[(E)-3-fluoroprop-2-enyl]-N,N,4,5-tetramethyldodeca-5,8,10-trien-4-amine (PubChem CID 130242940) has the molecular formula C22H34F3N and a molecular weight of 369.52 g/mol. Its IUPAC name is (5Z,8Z,10Z)-8-(1,3-difluoroprop-1-enyl)-6-[(E)-3-fluoroprop-2-enyl]-N,N,4,5-tetramethyldodeca-5,8,10-trien-4-amine.
| Compound Name | (5Z,8Z,10Z)-8-(1,3-difluoroprop-1-enyl)-6-[(E)-3-fluoroprop-2-enyl]-N,N,4,5-tetramethyldodeca-5,8,10-trien-4-amine |
|---|---|
| PubChem CID | 130242940 |
| Molecular Formula | C22H34F3N |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (5Z,8Z,10Z)-8-(1,3-difluoroprop-1-enyl)-6-[(E)-3-fluoroprop-2-enyl]-N,N,4,5-tetramethyldodeca-5,8,10-trien-4-amine |
| SMILES | C/C=C\C=C(\C/C(C/C=C/F)=C(/C)C(C)(CCC)N(C)C)C(F)=CCF |
| InChI | InChI=1S/C22H34F3N/c1-7-9-11-20(21(25)13-16-24)17-19(12-10-15-23)18(3)22(4,14-8-2)26(5)6/h7,9-11,13,15H,8,12,14,16-17H2,1-6H3/b9-7-,15-10+,19-18-,20-11-,21-13? |
| InChIKey | CVCSHTZEPPHXHX-QSRJIKBXSA-N |
| XLogP | 7.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|