C24H38FN — CID 130242987
(3Z)-N-(7-fluoronon-3-en-8-ynyl)-N,4,5-trimethyl-3-prop-1-en-2-ylnona-1,3-dien-2-amine (PubChem CID 130242987) has the molecular formula C24H38FN and a molecular weight of 359.57 g/mol. Its IUPAC name is (3Z)-N-(7-fluoronon-3-en-8-ynyl)-N,4,5-trimethyl-3-prop-1-en-2-ylnona-1,3-dien-2-amine.
| Compound Name | (3Z)-N-(7-fluoronon-3-en-8-ynyl)-N,4,5-trimethyl-3-prop-1-en-2-ylnona-1,3-dien-2-amine |
|---|---|
| PubChem CID | 130242987 |
| Molecular Formula | C24H38FN |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | (3Z)-N-(7-fluoronon-3-en-8-ynyl)-N,4,5-trimethyl-3-prop-1-en-2-ylnona-1,3-dien-2-amine |
| SMILES | C#CC(F)CCC=CCCN(C)C(=C)/C(C(=C)C)=C(/C)C(C)CCCC |
| InChI | InChI=1S/C24H38FN/c1-9-11-16-20(5)21(6)24(19(3)4)22(7)26(8)18-15-13-12-14-17-23(25)10-2/h2,12-13,20,23H,3,7,9,11,14-18H2,1,4-6,8H3/b13-12?,24-21- |
| InChIKey | RDWIMWCUKBSGMR-CCEFZLMMSA-N |
| XLogP | 6.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|