C17H32F3N3 — CID 130243016
(E)-3-ethyl-9,9,9-trifluoro-1-[[(3S)-3-(methylamino)pentylidene]amino]non-6-en-4-amine (PubChem CID 130243016) has the molecular formula C17H32F3N3 and a molecular weight of 335.46 g/mol. Its IUPAC name is (E)-3-ethyl-9,9,9-trifluoro-1-[[(3S)-3-(methylamino)pentylidene]amino]non-6-en-4-amine.
| Compound Name | (E)-3-ethyl-9,9,9-trifluoro-1-[[(3S)-3-(methylamino)pentylidene]amino]non-6-en-4-amine |
|---|---|
| PubChem CID | 130243016 |
| Molecular Formula | C17H32F3N3 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (E)-3-ethyl-9,9,9-trifluoro-1-[[(3S)-3-(methylamino)pentylidene]amino]non-6-en-4-amine |
| SMILES | CCC(CC/N=C/C[C@H](CC)NC)C(N)C/C=C/CC(F)(F)F |
| InChI | InChI=1S/C17H32F3N3/c1-4-14(9-12-23-13-10-15(5-2)22-3)16(21)8-6-7-11-17(18,19)20/h6-7,13-16,22H,4-5,8-12,21H2,1-3H3/b7-6+,23-13+/t14?,15-,16?/m0/s1 |
| InChIKey | KGSIZRQGVNBNDD-NLJANENCSA-N |
| XLogP | 4.09 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|