About (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine
(2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine (PubChem CID 130243053) has the molecular formula C9H10F3N
and a molecular weight of 189.18 g/mol. Its IUPAC name is (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine.
Molecular Properties
| Compound Name | (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine |
| PubChem CID | 130243053 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine |
| SMILES | C/C1=C/N=C\C=C(\C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F3N/c1-7-2-3-8(9(10,11)12)4-5-13-6-7/h4-6H,2-3H2,1H3/b7-6-,8-4+,13-5- |
| InChIKey | RCLXVWVAHWXMHQ-UZDYQCQZSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine?
The IUPAC name of (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine (CID 130243053) is (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine.
What is the SMILES notation for (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine?
The canonical SMILES for (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine is C/C1=C/N=C\C=C(\C(F)(F)F)CC1.
What is the InChIKey of (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine?
The InChIKey is RCLXVWVAHWXMHQ-UZDYQCQZSA-N. The full InChI is InChI=1S/C9H10F3N/c1-7-2-3-8(9(10,11)12)4-5-13-6-7/h4-6H,2-3H2,1H3/b7-6-,8-4+,13-5-.
What are the key properties of (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine?
(2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine has a molecular weight of 189.18 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-3-methyl-6-(trifluoromethyl)-4,5-dihydroazocine is sourced from PubChem (CID 130243053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).