About (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide
(4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide (PubChem CID 130243073) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide.
Molecular Properties
| Compound Name | (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide |
| PubChem CID | 130243073 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide |
| SMILES | C=C/C(=C\C=C/C)CCC(=O)NC |
| InChI | InChI=1S/C11H17NO/c1-4-6-7-10(5-2)8-9-11(13)12-3/h4-7H,2,8-9H2,1,3H3,(H,12,13)/b6-4-,10-7+ |
| InChIKey | PSQWVUBXBKYQMS-BSAFSDHNSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide?
The IUPAC name of (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide (CID 130243073) is (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide.
What is the SMILES notation for (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide?
The canonical SMILES for (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide is C=C/C(=C\C=C/C)CCC(=O)NC.
What is the InChIKey of (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide?
The InChIKey is PSQWVUBXBKYQMS-BSAFSDHNSA-N. The full InChI is InChI=1S/C11H17NO/c1-4-6-7-10(5-2)8-9-11(13)12-3/h4-7H,2,8-9H2,1,3H3,(H,12,13)/b6-4-,10-7+.
What are the key properties of (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide?
(4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide has a molecular weight of 179.26 g/mol, XLogP of 2.20, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-4-ethenyl-N-methylocta-4,6-dienamide is sourced from PubChem (CID 130243073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).