C28H40F2N2 — CID 130243083
(5E,7Z)-8-[(Z)-1,2-difluoroethenyl]-2-(2,4-dimethylpenta-1,4-dien-3-ylidene)-11-piperidin-1-yl-3-propan-2-ylundeca-5,7-dienenitrile (PubChem CID 130243083) has the molecular formula C28H40F2N2 and a molecular weight of 442.64 g/mol. Its IUPAC name is (5E,7Z)-8-[(Z)-1,2-difluoroethenyl]-2-(2,4-dimethylpenta-1,4-dien-3-ylidene)-11-piperidin-1-yl-3-propan-2-ylundeca-5,7-dienenitrile.
| Compound Name | (5E,7Z)-8-[(Z)-1,2-difluoroethenyl]-2-(2,4-dimethylpenta-1,4-dien-3-ylidene)-11-piperidin-1-yl-3-propan-2-ylundeca-5,7-dienenitrile |
|---|---|
| PubChem CID | 130243083 |
| Molecular Formula | C28H40F2N2 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (5E,7Z)-8-[(Z)-1,2-difluoroethenyl]-2-(2,4-dimethylpenta-1,4-dien-3-ylidene)-11-piperidin-1-yl-3-propan-2-ylundeca-5,7-dienenitrile |
| SMILES | C=C(C)C(C(=C)C)=C(C#N)C(C/C=C/C=C(CCCN1CCCCC1)\C(F)=C\F)C(C)C |
| InChI | InChI=1S/C28H40F2N2/c1-21(2)25(26(20-31)28(22(3)4)23(5)6)15-9-8-13-24(27(30)19-29)14-12-18-32-16-10-7-11-17-32/h8-9,13,19,21,25H,3,5,7,10-12,14-18H2,1-2,4,6H3/b9-8+,24-13-,27-19- |
| InChIKey | LWVWPEVOGVSYKE-LHDMEZBXSA-N |
| XLogP | 8.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|