C28H48FN — CID 130243094
(3Z)-3-ethyl-N-[(2E,4Z)-5-[(E)-3-fluorobut-2-en-2-yl]nona-2,4-dienyl]-N,4,5-trimethyldeca-1,3-dien-2-amine (PubChem CID 130243094) has the molecular formula C28H48FN and a molecular weight of 417.70 g/mol. Its IUPAC name is (3Z)-3-ethyl-N-[(2E,4Z)-5-[(E)-3-fluorobut-2-en-2-yl]nona-2,4-dienyl]-N,4,5-trimethyldeca-1,3-dien-2-amine.
| Compound Name | (3Z)-3-ethyl-N-[(2E,4Z)-5-[(E)-3-fluorobut-2-en-2-yl]nona-2,4-dienyl]-N,4,5-trimethyldeca-1,3-dien-2-amine |
|---|---|
| PubChem CID | 130243094 |
| Molecular Formula | C28H48FN |
| Molecular Weight | 417.70 g/mol |
| Exact Mass | 417.38 |
| IUPAC Name | (3Z)-3-ethyl-N-[(2E,4Z)-5-[(E)-3-fluorobut-2-en-2-yl]nona-2,4-dienyl]-N,4,5-trimethyldeca-1,3-dien-2-amine |
| SMILES | C=C(/C(CC)=C(/C)C(C)CCCCC)N(C)C/C=C/C=C(CCCC)\C(C)=C(/C)F |
| InChI | InChI=1S/C28H48FN/c1-10-13-15-18-22(4)23(5)28(12-3)26(8)30(9)21-17-16-20-27(19-14-11-2)24(6)25(7)29/h16-17,20,22H,8,10-15,18-19,21H2,1-7,9H3/b17-16+,25-24+,27-20-,28-23- |
| InChIKey | GRFZCQZEJKNVMY-HOJPRROGSA-N |
| XLogP | 9.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.70 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|