C20H34FN — CID 130243097
N-ethyl-N-[3-[(4Z)-5-ethyl-8-fluoro-6-methylcycloocta-1,4,6-trien-1-yl]propyl]butan-1-amine (PubChem CID 130243097) has the molecular formula C20H34FN and a molecular weight of 307.50 g/mol. Its IUPAC name is N-ethyl-N-[3-[(4Z)-5-ethyl-8-fluoro-6-methylcycloocta-1,4,6-trien-1-yl]propyl]butan-1-amine.
| Compound Name | N-ethyl-N-[3-[(4Z)-5-ethyl-8-fluoro-6-methylcycloocta-1,4,6-trien-1-yl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 130243097 |
| Molecular Formula | C20H34FN |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.27 |
| IUPAC Name | N-ethyl-N-[3-[(4Z)-5-ethyl-8-fluoro-6-methylcycloocta-1,4,6-trien-1-yl]propyl]butan-1-amine |
| SMILES | CCCCN(CC)CCCC1=CC/C=C(/CC)C(C)=CC1F |
| InChI | InChI=1S/C20H34FN/c1-5-8-14-22(7-3)15-10-13-19-12-9-11-18(6-2)17(4)16-20(19)21/h11-12,16,20H,5-10,13-15H2,1-4H3/b17-16?,18-11-,19-12? |
| InChIKey | ZMUUXXWOIVMMDG-WBXVHMDHSA-N |
| XLogP | 5.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|