About N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide
N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide (PubChem CID 130243164) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide.
Molecular Properties
| Compound Name | N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide |
| PubChem CID | 130243164 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide |
| SMILES | C=C/C(CC)=C(C)/C(CC)=N/C=N/C(C)C |
| InChI | InChI=1S/C14H24N2/c1-7-13(8-2)12(6)14(9-3)16-10-15-11(4)5/h7,10-11H,1,8-9H2,2-6H3/b13-12-,15-10+,16-14+ |
| InChIKey | KZUROGHQGFINJM-QTOLXONMSA-N |
| XLogP | 4.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide?
The IUPAC name of N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide (CID 130243164) is N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide.
What is the SMILES notation for N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide?
The canonical SMILES for N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide is C=C/C(CC)=C(C)/C(CC)=N/C=N/C(C)C.
What is the InChIKey of N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide?
The InChIKey is KZUROGHQGFINJM-QTOLXONMSA-N. The full InChI is InChI=1S/C14H24N2/c1-7-13(8-2)12(6)14(9-3)16-10-15-11(4)5/h7,10-11H,1,8-9H2,2-6H3/b13-12-,15-10+,16-14+.
What are the key properties of N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide?
N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide has a molecular weight of 220.36 g/mol, XLogP of 4.19, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4E)-5-ethyl-4-methylhepta-4,6-dien-3-ylidene]-N'-propan-2-ylmethanimidamide is sourced from PubChem (CID 130243164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).