C13H20N2 — CID 130243187
(1Z,5Z)-3-N,6-dimethyl-1-N,4-dimethylidenenona-1,5-diene-1,3-diimine (PubChem CID 130243187) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (1Z,5Z)-3-N,6-dimethyl-1-N,4-dimethylidenenona-1,5-diene-1,3-diimine.
| Compound Name | (1Z,5Z)-3-N,6-dimethyl-1-N,4-dimethylidenenona-1,5-diene-1,3-diimine |
|---|---|
| PubChem CID | 130243187 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (1Z,5Z)-3-N,6-dimethyl-1-N,4-dimethylidenenona-1,5-diene-1,3-diimine |
| SMILES | C=N/C=C\C(=N/C)C(=C)/C=C(/C)CCC |
| InChI | InChI=1S/C13H20N2/c1-6-7-11(2)10-12(3)13(15-5)8-9-14-4/h8-10H,3-4,6-7H2,1-2,5H3/b9-8-,11-10-,15-13+ |
| InChIKey | XRWMBGDZLAUHCM-OJVFXJKKSA-N |
| XLogP | 3.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|