C24H33FN2 — CID 130243205
(3E)-2-N-[7-[(3Z)-4-fluorobuta-1,3-dien-2-yl]-5-methylcyclohepta-1,4,6-trien-1-yl]-5-N,5-N,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene-2,5-diamine (PubChem CID 130243205) has the molecular formula C24H33FN2 and a molecular weight of 368.54 g/mol. Its IUPAC name is (3E)-2-N-[7-[(3Z)-4-fluorobuta-1,3-dien-2-yl]-5-methylcyclohepta-1,4,6-trien-1-yl]-5-N,5-N,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene-2,5-diamine.
| Compound Name | (3E)-2-N-[7-[(3Z)-4-fluorobuta-1,3-dien-2-yl]-5-methylcyclohepta-1,4,6-trien-1-yl]-5-N,5-N,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene-2,5-diamine |
|---|---|
| PubChem CID | 130243205 |
| Molecular Formula | C24H33FN2 |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (3E)-2-N-[7-[(3Z)-4-fluorobuta-1,3-dien-2-yl]-5-methylcyclohepta-1,4,6-trien-1-yl]-5-N,5-N,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene-2,5-diamine |
| SMILES | C=C(/C=C\F)C1=CC(C)=CCC=C1NC(=C)/C(=C/C(C)(C)N(C)C)C(=C)C |
| InChI | InChI=1S/C24H33FN2/c1-17(2)22(16-24(6,7)27(8)9)20(5)26-23-12-10-11-18(3)15-21(23)19(4)13-14-25/h11-16,26H,1,4-5,10H2,2-3,6-9H3/b14-13-,22-16+ |
| InChIKey | VMLHPWBXIKGVRJ-GXZYYBBXSA-N |
| XLogP | 6.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|