C14H23F2N — CID 130243324
7,9-difluoro-N,4-dimethyl-6-methylideneundeca-7,10-dien-1-amine (PubChem CID 130243324) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 7,9-difluoro-N,4-dimethyl-6-methylideneundeca-7,10-dien-1-amine.
| Compound Name | 7,9-difluoro-N,4-dimethyl-6-methylideneundeca-7,10-dien-1-amine |
|---|---|
| PubChem CID | 130243324 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 7,9-difluoro-N,4-dimethyl-6-methylideneundeca-7,10-dien-1-amine |
| SMILES | C=CC(F)C=C(F)C(=C)CC(C)CCCNC |
| InChI | InChI=1S/C14H23F2N/c1-5-13(15)10-14(16)12(3)9-11(2)7-6-8-17-4/h5,10-11,13,17H,1,3,6-9H2,2,4H3 |
| InChIKey | DJUWVVZLZIRRNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|