C19H29F2N3 — CID 130243383
N-[(2E,4Z,6Z)-6,7-difluorohepta-2,4,6-trienyl]-N-methyl-2-[(2E)-3-methyl-4-(methylamino)penta-2,4-dien-2-yl]pyrrolidin-1-amine (PubChem CID 130243383) has the molecular formula C19H29F2N3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[(2E,4Z,6Z)-6,7-difluorohepta-2,4,6-trienyl]-N-methyl-2-[(2E)-3-methyl-4-(methylamino)penta-2,4-dien-2-yl]pyrrolidin-1-amine.
| Compound Name | N-[(2E,4Z,6Z)-6,7-difluorohepta-2,4,6-trienyl]-N-methyl-2-[(2E)-3-methyl-4-(methylamino)penta-2,4-dien-2-yl]pyrrolidin-1-amine |
|---|---|
| PubChem CID | 130243383 |
| Molecular Formula | C19H29F2N3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-[(2E,4Z,6Z)-6,7-difluorohepta-2,4,6-trienyl]-N-methyl-2-[(2E)-3-methyl-4-(methylamino)penta-2,4-dien-2-yl]pyrrolidin-1-amine |
| SMILES | C=C(NC)/C(C)=C(\C)C1CCCN1N(C)C/C=C/C=C\C(F)=C\F |
| InChI | InChI=1S/C19H29F2N3/c1-15(17(3)22-4)16(2)19-11-9-13-24(19)23(5)12-8-6-7-10-18(21)14-20/h6-8,10,14,19,22H,3,9,11-13H2,1-2,4-5H3/b8-6+,10-7-,16-15+,18-14- |
| InChIKey | SPQBUHPDSVBDEE-XOSZBYMTSA-N |
| XLogP | 4.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|