C15H25F2N — CID 130243422
(4Z)-4-[(Z)-1,2-difluoroethenyl]-N,N-dipropylhepta-4,6-dien-1-amine (PubChem CID 130243422) has the molecular formula C15H25F2N and a molecular weight of 257.37 g/mol. Its IUPAC name is (4Z)-4-[(Z)-1,2-difluoroethenyl]-N,N-dipropylhepta-4,6-dien-1-amine.
| Compound Name | (4Z)-4-[(Z)-1,2-difluoroethenyl]-N,N-dipropylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 130243422 |
| Molecular Formula | C15H25F2N |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (4Z)-4-[(Z)-1,2-difluoroethenyl]-N,N-dipropylhepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(CCCN(CCC)CCC)\C(F)=C\F |
| InChI | InChI=1S/C15H25F2N/c1-4-8-14(15(17)13-16)9-7-12-18(10-5-2)11-6-3/h4,8,13H,1,5-7,9-12H2,2-3H3/b14-8-,15-13- |
| InChIKey | PMRNRDSSIMWPKD-GMTFKXOCSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|