About tricyclo[5.2.1.02,6]dec-4-en-3-ol
tricyclo[5.2.1.02,6]dec-4-en-3-ol (PubChem CID 13024353) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]dec-4-en-3-ol.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]dec-4-en-3-ol |
| PubChem CID | 13024353 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | tricyclo[5.2.1.02,6]dec-4-en-3-ol |
| SMILES | OC1C=CC2C3CCC(C3)C12 |
| InChI | InChI=1S/C10H14O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h3-4,6-11H,1-2,5H2 |
| InChIKey | HRWRJUVJOLBMST-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]dec-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]dec-4-en-3-ol?
The IUPAC name of tricyclo[5.2.1.02,6]dec-4-en-3-ol (CID 13024353) is tricyclo[5.2.1.02,6]dec-4-en-3-ol.
What is the SMILES notation for tricyclo[5.2.1.02,6]dec-4-en-3-ol?
The canonical SMILES for tricyclo[5.2.1.02,6]dec-4-en-3-ol is OC1C=CC2C3CCC(C3)C12.
What is the InChIKey of tricyclo[5.2.1.02,6]dec-4-en-3-ol?
The InChIKey is HRWRJUVJOLBMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h3-4,6-11H,1-2,5H2.
What are the key properties of tricyclo[5.2.1.02,6]dec-4-en-3-ol?
tricyclo[5.2.1.02,6]dec-4-en-3-ol has a molecular weight of 150.22 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]dec-4-en-3-ol is sourced from PubChem (CID 13024353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).