C29H35N5O6S — CID 130243556
N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3-methylperoxysulfanylbenzoyl)amino]piperidine-1-carboxamide (PubChem CID 130243556) has the molecular formula C29H35N5O6S and a molecular weight of 581.70 g/mol. Its IUPAC name is N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3-methylperoxysulfanylbenzoyl)amino]piperidine-1-carboxamide.
| Compound Name | N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3-methylperoxysulfanylbenzoyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 130243556 |
| Molecular Formula | C29H35N5O6S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3-methylperoxysulfanylbenzoyl)amino]piperidine-1-carboxamide |
| SMILES | COOSc1cccc(C(=O)NC2CCCN(C(=O)Nc3ccc4c(c3)c(=O)n(CC3CC3)c(=O)n4C(C)C)C2)c1 |
| InChI | InChI=1S/C29H35N5O6S/c1-18(2)34-25-12-11-21(15-24(25)27(36)33(29(34)38)16-19-9-10-19)31-28(37)32-13-5-7-22(17-32)30-26(35)20-6-4-8-23(14-20)41-40-39-3/h4,6,8,11-12,14-15,18-19,22H,5,7,9-10,13,16-17H2,1-3H3,(H,30,35)(H,31,37) |
| InChIKey | PDLOKSFLJVKHNL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|