About (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide
(2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide (PubChem CID 130243604) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide |
| PubChem CID | 130243604 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide |
| SMILES | C=C/C=C\C(=O)N(C)CCCCCCCCO |
| InChI | InChI=1S/C14H25NO2/c1-3-4-11-14(17)15(2)12-9-7-5-6-8-10-13-16/h3-4,11,16H,1,5-10,12-13H2,2H3/b11-4- |
| InChIKey | BBNRBCMUPGRBLK-WCIBSUBMSA-N |
| XLogP | 2.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide?
The IUPAC name of (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide (CID 130243604) is (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide.
What is the SMILES notation for (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide?
The canonical SMILES for (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide is C=C/C=C\C(=O)N(C)CCCCCCCCO.
What is the InChIKey of (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide?
The InChIKey is BBNRBCMUPGRBLK-WCIBSUBMSA-N. The full InChI is InChI=1S/C14H25NO2/c1-3-4-11-14(17)15(2)12-9-7-5-6-8-10-13-16/h3-4,11,16H,1,5-10,12-13H2,2H3/b11-4-.
What are the key properties of (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide?
(2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide has a molecular weight of 239.36 g/mol, XLogP of 2.52, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-(8-hydroxyoctyl)-N-methylpenta-2,4-dienamide is sourced from PubChem (CID 130243604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).