C24H35N13O — CID 130243791
2-N-[[[4-(dimethylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]-2-N-[2-(5-methylfuran-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 130243791) has the molecular formula C24H35N13O and a molecular weight of 521.63 g/mol. Its IUPAC name is 2-N-[[[4-(dimethylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]-2-N-[2-(5-methylfuran-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[[4-(dimethylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]-2-N-[2-(5-methylfuran-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 130243791 |
| Molecular Formula | C24H35N13O |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 2-N-[[[4-(dimethylamino)-6-[2-(5-methyl-1H-pyrrol-2-yl)ethylamino]-1,3,5-triazin-2-yl]-methylamino]methyl]-2-N-[2-(5-methylfuran-2-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(CCNc2nc(N(C)C)nc(N(C)CN(CCc3ccc(C)o3)c3nc(N)nc(N)n3)n2)[nH]1 |
| InChI | InChI=1S/C24H35N13O/c1-15-6-8-17(28-15)10-12-27-21-32-22(35(3)4)34-23(33-21)36(5)14-37(13-11-18-9-7-16(2)38-18)24-30-19(25)29-20(26)31-24/h6-9,28H,10-14H2,1-5H3,(H,27,32,33,34)(H4,25,26,29,30,31) |
| InChIKey | MOJGJFALRRJKSD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 180.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|