C11H19NO — CID 130243944
(3Z,5Z)-5-[2-(methylamino)ethyl]octa-1,3,5-trien-2-ol (PubChem CID 130243944) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3Z,5Z)-5-[2-(methylamino)ethyl]octa-1,3,5-trien-2-ol.
| Compound Name | (3Z,5Z)-5-[2-(methylamino)ethyl]octa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 130243944 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3Z,5Z)-5-[2-(methylamino)ethyl]octa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C/CC)CCNC |
| InChI | InChI=1S/C11H19NO/c1-4-5-11(8-9-12-3)7-6-10(2)13/h5-7,12-13H,2,4,8-9H2,1,3H3/b7-6-,11-5+ |
| InChIKey | CWYLTEAXLVBZQR-TUKAJDRUSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|