C20H28ClN3O3S — CID 130244535
5-butoxy-N-[2-(4-chlorophenyl)ethylsulfamoyl]-3,4,6-trimethylpyridin-2-amine (PubChem CID 130244535) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is 5-butoxy-N-[2-(4-chlorophenyl)ethylsulfamoyl]-3,4,6-trimethylpyridin-2-amine.
| Compound Name | 5-butoxy-N-[2-(4-chlorophenyl)ethylsulfamoyl]-3,4,6-trimethylpyridin-2-amine |
|---|---|
| PubChem CID | 130244535 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-butoxy-N-[2-(4-chlorophenyl)ethylsulfamoyl]-3,4,6-trimethylpyridin-2-amine |
| SMILES | CCCCOc1c(C)nc(NS(=O)(=O)NCCc2ccc(Cl)cc2)c(C)c1C |
| InChI | InChI=1S/C20H28ClN3O3S/c1-5-6-13-27-19-14(2)15(3)20(23-16(19)4)24-28(25,26)22-12-11-17-7-9-18(21)10-8-17/h7-10,22H,5-6,11-13H2,1-4H3,(H,23,24) |
| InChIKey | VCXQBHCTQUQLSA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|