C27H34FN8O4P — CID 130244692
N-[9-[(3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluoro-5-[(methylideneamino)methyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 130244692) has the molecular formula C27H34FN8O4P and a molecular weight of 584.59 g/mol. Its IUPAC name is N-[9-[(3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluoro-5-[(methylideneamino)methyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluoro-5-[(methylideneamino)methyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 130244692 |
| Molecular Formula | C27H34FN8O4P |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | N-[9-[(3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-fluoro-5-[(methylideneamino)methyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | C=NC[C@H]1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](F)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H34FN8O4P/c1-17(2)36(18(3)4)41(38-13-9-12-29)40-23-20(14-30-5)39-27(21(23)28)35-16-33-22-24(31-15-32-25(22)35)34-26(37)19-10-7-6-8-11-19/h6-8,10-11,15-18,20-21,23,27H,5,9,13-14H2,1-4H3,(H,31,32,34,37)/t20-,21-,23-,27?,41?/m1/s1 |
| InChIKey | YYLHGIXSVTVXOH-MAMKUBFUSA-N |
| XLogP | 4.68 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|