C13H20O6 — CID 130244719
(4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one (PubChem CID 130244719) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one.
| Compound Name | (4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
|---|---|
| PubChem CID | 130244719 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
| SMILES | CC1(C)OCC([C@@H]2OC(=O)CC3OC(C)(C)OC32)O1 |
| InChI | InChI=1S/C13H20O6/c1-12(2)15-6-8(18-12)10-11-7(5-9(14)16-10)17-13(3,4)19-11/h7-8,10-11H,5-6H2,1-4H3/t7?,8?,10-,11?/m0/s1 |
| InChIKey | UXHSJUSYRJAFHP-JRASRSEESA-N |
| XLogP | 0.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |