About N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide
N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide (PubChem CID 130244875) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide |
| PubChem CID | 130244875 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide |
| SMILES | CCc1cnc(N(C)C(=O)C(C)(C)C)nc1C |
| InChI | InChI=1S/C13H21N3O/c1-7-10-8-14-12(15-9(10)2)16(6)11(17)13(3,4)5/h8H,7H2,1-6H3 |
| InChIKey | RHGQTRYXTFRDPR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide?
The IUPAC name of N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide (CID 130244875) is N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide?
The canonical SMILES for N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide is CCc1cnc(N(C)C(=O)C(C)(C)C)nc1C.
What is the InChIKey of N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide?
The InChIKey is RHGQTRYXTFRDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-7-10-8-14-12(15-9(10)2)16(6)11(17)13(3,4)5/h8H,7H2,1-6H3.
What are the key properties of N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide?
N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide has a molecular weight of 235.33 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-4-methylpyrimidin-2-yl)-N,2,2-trimethylpropanamide is sourced from PubChem (CID 130244875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).