C24H34O — CID 130245643
(3Z,5E)-5-[2-[(3E,5Z)-8,8-dimethyl-7-methylidenenona-1,3,5-trien-4-yl]oxypropan-2-yl]-2-methylocta-1,3,5,7-tetraene (PubChem CID 130245643) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is (3Z,5E)-5-[2-[(3E,5Z)-8,8-dimethyl-7-methylidenenona-1,3,5-trien-4-yl]oxypropan-2-yl]-2-methylocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5E)-5-[2-[(3E,5Z)-8,8-dimethyl-7-methylidenenona-1,3,5-trien-4-yl]oxypropan-2-yl]-2-methylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 130245643 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (3Z,5E)-5-[2-[(3E,5Z)-8,8-dimethyl-7-methylidenenona-1,3,5-trien-4-yl]oxypropan-2-yl]-2-methylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C(\C=C/C(=C)C(C)(C)C)OC(C)(C)C(/C=C\C(=C)C)=C/C=C |
| InChI | InChI=1S/C24H34O/c1-11-13-21(17-15-19(3)4)24(9,10)25-22(14-12-2)18-16-20(5)23(6,7)8/h11-18H,1-3,5H2,4,6-10H3/b17-15-,18-16-,21-13+,22-14+ |
| InChIKey | XCHZOGSGJCWURV-FNNPCALUSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|