C21H33N3O7 — CID 130246050
tert-butyl 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoyl]-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]hydrazinyl]propanoate (PubChem CID 130246050) has the molecular formula C21H33N3O7 and a molecular weight of 439.51 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoyl]-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]hydrazinyl]propanoate.
| Compound Name | tert-butyl 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoyl]-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]hydrazinyl]propanoate |
|---|---|
| PubChem CID | 130246050 |
| Molecular Formula | C21H33N3O7 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | tert-butyl 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoyl]-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]hydrazinyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNN(CCC(=O)OC(C)(C)C)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H33N3O7/c1-20(2,3)30-18(28)9-12-22-24(14-11-19(29)31-21(4,5)6)17(27)10-13-23-15(25)7-8-16(23)26/h7-8,22H,9-14H2,1-6H3 |
| InChIKey | VCSZZZJJRNPKGG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|