About 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione
5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 130246360) has the molecular formula C20H19FN2O2
and a molecular weight of 338.38 g/mol. Its IUPAC name is 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione |
| PubChem CID | 130246360 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | O=c1c(F)cn(CCc2ccccc2)c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C20H19FN2O2/c21-18-15-22(13-11-16-7-3-1-4-8-16)20(25)23(19(18)24)14-12-17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | VQIJBTBYYHIKMI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione (CID 130246360) is 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione is O=c1c(F)cn(CCc2ccccc2)c(=O)n1CCc1ccccc1.
What is the InChIKey of 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione?
The InChIKey is VQIJBTBYYHIKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19FN2O2/c21-18-15-22(13-11-16-7-3-1-4-8-16)20(25)23(19(18)24)14-12-17-9-5-2-6-10-17/h1-10,15H,11-14H2.
What are the key properties of 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione?
5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione has a molecular weight of 338.38 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-bis(2-phenylethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 130246360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).