C16H27FN2O2 — CID 130246409
5-fluoro-1,3-dihexylpyrimidine-2,4-dione (PubChem CID 130246409) has the molecular formula C16H27FN2O2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 5-fluoro-1,3-dihexylpyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1,3-dihexylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 130246409 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 5-fluoro-1,3-dihexylpyrimidine-2,4-dione |
| SMILES | CCCCCCn1cc(F)c(=O)n(CCCCCC)c1=O |
| InChI | InChI=1S/C16H27FN2O2/c1-3-5-7-9-11-18-13-14(17)15(20)19(16(18)21)12-10-8-6-4-2/h13H,3-12H2,1-2H3 |
| InChIKey | UISRLVHFHGWAJZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|