C26H26N10O6S — CID 130246479
4-[[9-(1,3-benzothiazol-2-ylmethyl)-2-(3-oxopiperazin-1-yl)purin-6-yl]amino]-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 130246479) has the molecular formula C26H26N10O6S and a molecular weight of 606.63 g/mol. Its IUPAC name is 4-[[9-(1,3-benzothiazol-2-ylmethyl)-2-(3-oxopiperazin-1-yl)purin-6-yl]amino]-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-[[9-(1,3-benzothiazol-2-ylmethyl)-2-(3-oxopiperazin-1-yl)purin-6-yl]amino]-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 130246479 |
| Molecular Formula | C26H26N10O6S |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | 4-[[9-(1,3-benzothiazol-2-ylmethyl)-2-(3-oxopiperazin-1-yl)purin-6-yl]amino]-1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | O=C1CN(c2nc(Nc3ccn(C4O[C@H](CO)[C@@H](O)[C@H]4O)c(=O)n3)c3ncn(Cc4nc5ccccc5s4)c3n2)CCN1 |
| InChI | InChI=1S/C26H26N10O6S/c37-11-14-20(39)21(40)24(42-14)36-7-5-16(31-26(36)41)30-22-19-23(33-25(32-22)34-8-6-27-17(38)9-34)35(12-28-19)10-18-29-13-3-1-2-4-15(13)43-18/h1-5,7,12,14,20-21,24,37,39-40H,6,8-11H2,(H,27,38)(H,30,31,32,33,41)/t14-,20-,21-,24?/m1/s1 |
| InChIKey | KKVPXQIVKDZERU-WUXFEECKSA-N |
| XLogP | -0.67 |
| TPSA | 205.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |