About 2-bromo-3,4,5,6-tetrafluorophenol
2-bromo-3,4,5,6-tetrafluorophenol (PubChem CID 13024657) has the molecular formula C6HBrF4O
and a molecular weight of 244.97 g/mol. Its IUPAC name is 2-bromo-3,4,5,6-tetrafluorophenol.
Molecular Properties
| Compound Name | 2-bromo-3,4,5,6-tetrafluorophenol |
| PubChem CID | 13024657 |
| Molecular Formula | C6HBrF4O |
| Molecular Weight | 244.97 g/mol |
| Exact Mass | 243.91 |
| IUPAC Name | 2-bromo-3,4,5,6-tetrafluorophenol |
| SMILES | Oc1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C6HBrF4O/c7-1-2(8)3(9)4(10)5(11)6(1)12/h12H |
| InChIKey | BAUAYFAYFRGXOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.97 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,4,5,6-tetrafluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4,5,6-tetrafluorophenol?
The IUPAC name of 2-bromo-3,4,5,6-tetrafluorophenol (CID 13024657) is 2-bromo-3,4,5,6-tetrafluorophenol.
What is the SMILES notation for 2-bromo-3,4,5,6-tetrafluorophenol?
The canonical SMILES for 2-bromo-3,4,5,6-tetrafluorophenol is Oc1c(F)c(F)c(F)c(F)c1Br.
What is the InChIKey of 2-bromo-3,4,5,6-tetrafluorophenol?
The InChIKey is BAUAYFAYFRGXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBrF4O/c7-1-2(8)3(9)4(10)5(11)6(1)12/h12H.
What are the key properties of 2-bromo-3,4,5,6-tetrafluorophenol?
2-bromo-3,4,5,6-tetrafluorophenol has a molecular weight of 244.97 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4,5,6-tetrafluorophenol is sourced from PubChem (CID 13024657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).