C25H20F2N4O2 — CID 130247008
1-[(3R)-3-[3-[4-(2,3-difluorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 130247008) has the molecular formula C25H20F2N4O2 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[(3R)-3-[3-[4-(2,3-difluorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-[4-(2,3-difluorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130247008 |
| Molecular Formula | C25H20F2N4O2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[(3R)-3-[3-[4-(2,3-difluorophenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2nc(-c3ccc(Oc4cccc(F)c4F)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C25H20F2N4O2/c1-2-23(32)30-13-11-17(15-30)31-21-10-12-28-14-19(21)25(29-31)16-6-8-18(9-7-16)33-22-5-3-4-20(26)24(22)27/h2-10,12,14,17H,1,11,13,15H2/t17-/m1/s1 |
| InChIKey | AQAXEHRCGCHUEE-QGZVFWFLSA-N |
| XLogP | 5.13 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|