About N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide
N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide (PubChem CID 130247457) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide.
Molecular Properties
| Compound Name | N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide |
| PubChem CID | 130247457 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide |
| SMILES | C=CN(C=C)C(/C=N/C)=N\C |
| InChI | InChI=1S/C8H13N3/c1-5-11(6-2)8(10-4)7-9-3/h5-7H,1-2H2,3-4H3/b9-7+,10-8- |
| InChIKey | KHAHJXXMFFNGDO-ZWOQCJTASA-N |
| XLogP | 1.30 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide?
The IUPAC name of N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide (CID 130247457) is N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide.
What is the SMILES notation for N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide?
The canonical SMILES for N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide is C=CN(C=C)C(/C=N/C)=N\C.
What is the InChIKey of N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide?
The InChIKey is KHAHJXXMFFNGDO-ZWOQCJTASA-N. The full InChI is InChI=1S/C8H13N3/c1-5-11(6-2)8(10-4)7-9-3/h5-7H,1-2H2,3-4H3/b9-7+,10-8-.
What are the key properties of N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide?
N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide has a molecular weight of 151.21 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(ethenyl)-N'-methyl-2-methyliminoethanimidamide is sourced from PubChem (CID 130247457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).