About methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride
methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride (PubChem CID 130247458) has the molecular formula C13H18ClNO3
and a molecular weight of 271.74 g/mol. Its IUPAC name is methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride |
| PubChem CID | 130247458 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride |
| SMILES | COC(=O)CCN1CCc2cc(OC)ccc21.Cl |
| InChI | InChI=1S/C13H17NO3.ClH/c1-16-11-3-4-12-10(9-11)5-7-14(12)8-6-13(15)17-2;/h3-4,9H,5-8H2,1-2H3;1H |
| InChIKey | QIECOPMYCBJTLT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride?
The IUPAC name of methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride (CID 130247458) is methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride.
What is the SMILES notation for methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride?
The canonical SMILES for methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride is COC(=O)CCN1CCc2cc(OC)ccc21.Cl.
What is the InChIKey of methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride?
The InChIKey is QIECOPMYCBJTLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3.ClH/c1-16-11-3-4-12-10(9-11)5-7-14(12)8-6-13(15)17-2;/h3-4,9H,5-8H2,1-2H3;1H.
What are the key properties of methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride?
methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride has a molecular weight of 271.74 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5-methoxy-2,3-dihydroindol-1-yl)propanoate;hydrochloride is sourced from PubChem (CID 130247458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).