About 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole
2-hydroxy-3-methylbenzaldehyde;1-methylimidazole (PubChem CID 130247486) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole.
Molecular Properties
| Compound Name | 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole |
| PubChem CID | 130247486 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole |
| SMILES | Cc1cccc(C=O)c1O.Cn1ccnc1 |
| InChI | InChI=1S/C8H8O2.C4H6N2/c1-6-3-2-4-7(5-9)8(6)10;1-6-3-2-5-4-6/h2-5,10H,1H3;2-4H,1H3 |
| InChIKey | IYMJMIKOQFYNHN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole?
The IUPAC name of 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole (CID 130247486) is 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole.
What is the SMILES notation for 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole?
The canonical SMILES for 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole is Cc1cccc(C=O)c1O.Cn1ccnc1.
What is the InChIKey of 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole?
The InChIKey is IYMJMIKOQFYNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C4H6N2/c1-6-3-2-4-7(5-9)8(6)10;1-6-3-2-5-4-6/h2-5,10H,1H3;2-4H,1H3.
What are the key properties of 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole?
2-hydroxy-3-methylbenzaldehyde;1-methylimidazole has a molecular weight of 218.26 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methylbenzaldehyde;1-methylimidazole is sourced from PubChem (CID 130247486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).