About (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium
(2E,4E)-hexa-2,4-dienoate;piperidin-1-ium (PubChem CID 130247602) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium.
Molecular Properties
| Compound Name | (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium |
| PubChem CID | 130247602 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium |
| SMILES | C/C=C/C=C/C(=O)[O-].C1CC[NH2+]CC1 |
| InChI | InChI=1S/C6H8O2.C5H11N/c1-2-3-4-5-6(7)8;1-2-4-6-5-3-1/h2-5H,1H3,(H,7,8);6H,1-5H2/b3-2+,5-4+; |
| InChIKey | RUWAQEDSZHHDDH-STWYSWDKSA-N |
| XLogP | -0.40 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium?
The IUPAC name of (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium (CID 130247602) is (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium.
What is the SMILES notation for (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium?
The canonical SMILES for (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium is C/C=C/C=C/C(=O)[O-].C1CC[NH2+]CC1.
What is the InChIKey of (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium?
The InChIKey is RUWAQEDSZHHDDH-STWYSWDKSA-N. The full InChI is InChI=1S/C6H8O2.C5H11N/c1-2-3-4-5-6(7)8;1-2-4-6-5-3-1/h2-5H,1H3,(H,7,8);6H,1-5H2/b3-2+,5-4+;.
What are the key properties of (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium?
(2E,4E)-hexa-2,4-dienoate;piperidin-1-ium has a molecular weight of 197.28 g/mol, XLogP of -0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-hexa-2,4-dienoate;piperidin-1-ium is sourced from PubChem (CID 130247602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).