About 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride
3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride (PubChem CID 130247631) has the molecular formula C12H18ClNO2
and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride |
| PubChem CID | 130247631 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride |
| SMILES | COc1ccc2c(c1)CCN2CCCO.Cl |
| InChI | InChI=1S/C12H17NO2.ClH/c1-15-11-3-4-12-10(9-11)5-7-13(12)6-2-8-14;/h3-4,9,14H,2,5-8H2,1H3;1H |
| InChIKey | JBKPRSFSCYETEP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride?
The IUPAC name of 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride (CID 130247631) is 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride.
What is the SMILES notation for 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride?
The canonical SMILES for 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride is COc1ccc2c(c1)CCN2CCCO.Cl.
What is the InChIKey of 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride?
The InChIKey is JBKPRSFSCYETEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.ClH/c1-15-11-3-4-12-10(9-11)5-7-13(12)6-2-8-14;/h3-4,9,14H,2,5-8H2,1H3;1H.
What are the key properties of 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride?
3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride has a molecular weight of 243.73 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxy-2,3-dihydroindol-1-yl)propan-1-ol;hydrochloride is sourced from PubChem (CID 130247631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).