C20H17NO4S — CID 130247707
4-[(4-phenylphenyl)sulfamoylmethyl]benzoic acid (PubChem CID 130247707) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-[(4-phenylphenyl)sulfamoylmethyl]benzoic acid.
| Compound Name | 4-[(4-phenylphenyl)sulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 130247707 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[(4-phenylphenyl)sulfamoylmethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CS(=O)(=O)Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H17NO4S/c22-20(23)18-8-6-15(7-9-18)14-26(24,25)21-19-12-10-17(11-13-19)16-4-2-1-3-5-16/h1-13,21H,14H2,(H,22,23) |
| InChIKey | XFXNGQVPIGBFAQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |