C28H28N4O2 — CID 130247942
1-[(3R)-3-[3-[4-(2,3-dimethylphenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130247942) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[(3R)-3-[3-[4-(2,3-dimethylphenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-[4-(2,3-dimethylphenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130247942 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-[(3R)-3-[3-[4-(2,3-dimethylphenoxy)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4cccc(C)c4C)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C28H28N4O2/c1-4-27(33)31-16-6-8-22(18-31)32-25-14-15-29-17-24(25)28(30-32)21-10-12-23(13-11-21)34-26-9-5-7-19(2)20(26)3/h4-5,7,9-15,17,22H,1,6,8,16,18H2,2-3H3/t22-/m1/s1 |
| InChIKey | DDLFWGOXDXTLIM-JOCHJYFZSA-N |
| XLogP | 5.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|