C26H28N4O2S2 — CID 130248381
N-cyclopropyl-6-[[6-(1,4-oxazepan-4-yl)-2-pyridinyl]sulfanyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide (PubChem CID 130248381) has the molecular formula C26H28N4O2S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is N-cyclopropyl-6-[[6-(1,4-oxazepan-4-yl)-2-pyridinyl]sulfanyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide.
| Compound Name | N-cyclopropyl-6-[[6-(1,4-oxazepan-4-yl)-2-pyridinyl]sulfanyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide |
|---|---|
| PubChem CID | 130248381 |
| Molecular Formula | C26H28N4O2S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-cyclopropyl-6-[[6-(1,4-oxazepan-4-yl)-2-pyridinyl]sulfanyl]-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxamide |
| SMILES | O=C(NC1CC1)c1cc2c(s1)-c1ccccc1N(Sc1cccc(N3CCCOCC3)n1)CC2 |
| InChI | InChI=1S/C26H28N4O2S2/c31-26(27-19-9-10-19)22-17-18-11-13-30(21-6-2-1-5-20(21)25(18)33-22)34-24-8-3-7-23(28-24)29-12-4-15-32-16-14-29/h1-3,5-8,17,19H,4,9-16H2,(H,27,31) |
| InChIKey | LRNRYWXWOPWFQE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|