C9H17NO — CID 130249101
(5Z)-8-methoxy-4-methyl-1,2,3,4,7,8-hexahydroazocine (PubChem CID 130249101) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (5Z)-8-methoxy-4-methyl-1,2,3,4,7,8-hexahydroazocine.
| Compound Name | (5Z)-8-methoxy-4-methyl-1,2,3,4,7,8-hexahydroazocine |
|---|---|
| PubChem CID | 130249101 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (5Z)-8-methoxy-4-methyl-1,2,3,4,7,8-hexahydroazocine |
| SMILES | COC1C/C=C\C(C)CCN1 |
| InChI | InChI=1S/C9H17NO/c1-8-4-3-5-9(11-2)10-7-6-8/h3-4,8-10H,5-7H2,1-2H3/b4-3- |
| InChIKey | HVKAKDRJBGGARB-ARJAWSKDSA-N |
| XLogP | 1.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|