C11H20N2 — CID 130249103
(5Z)-N-cyclopropyl-4-methyl-1,2,3,4,7,8-hexahydroazocin-8-amine (PubChem CID 130249103) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is (5Z)-N-cyclopropyl-4-methyl-1,2,3,4,7,8-hexahydroazocin-8-amine.
| Compound Name | (5Z)-N-cyclopropyl-4-methyl-1,2,3,4,7,8-hexahydroazocin-8-amine |
|---|---|
| PubChem CID | 130249103 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (5Z)-N-cyclopropyl-4-methyl-1,2,3,4,7,8-hexahydroazocin-8-amine |
| SMILES | CC1/C=C\CC(NC2CC2)NCC1 |
| InChI | InChI=1S/C11H20N2/c1-9-3-2-4-11(12-8-7-9)13-10-5-6-10/h2-3,9-13H,4-8H2,1H3/b3-2- |
| InChIKey | SWVHBYCKRMCCKA-IHWYPQMZSA-N |
| XLogP | 1.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|