C41H62N2O2 — CID 130249350
1-(cyclobutylmethyl)-3-[(7E,9Z,11E)-7,9-dimethyl-2-oxopentadeca-7,9,11-trienyl]-8-pentan-2-yl-8-phenyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 130249350) has the molecular formula C41H62N2O2 and a molecular weight of 614.96 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-[(7E,9Z,11E)-7,9-dimethyl-2-oxopentadeca-7,9,11-trienyl]-8-pentan-2-yl-8-phenyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-(cyclobutylmethyl)-3-[(7E,9Z,11E)-7,9-dimethyl-2-oxopentadeca-7,9,11-trienyl]-8-pentan-2-yl-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 130249350 |
| Molecular Formula | C41H62N2O2 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 614.48 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-[(7E,9Z,11E)-7,9-dimethyl-2-oxopentadeca-7,9,11-trienyl]-8-pentan-2-yl-8-phenyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | CCC/C=C/C=C(C)\C=C(/C)CCCCC(=O)CN1CC2(CCC(c3ccccc3)(C(C)CCC)CC2)N(CC2CCC2)C1=O |
| InChI | InChI=1S/C41H62N2O2/c1-6-8-9-11-18-33(3)29-34(4)19-14-15-24-38(44)31-42-32-40(43(39(42)45)30-36-20-16-21-36)25-27-41(28-26-40,35(5)17-7-2)37-22-12-10-13-23-37/h9-13,18,22-23,29,35-36H,6-8,14-17,19-21,24-28,30-32H2,1-5H3/b11-9+,33-18-,34-29+ |
| InChIKey | SLWLUTWVPPXJOF-NSCXMPSISA-N |
| XLogP | 10.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|