C29H27N5O3 — CID 130249609
2-[3-(6-aminopyrimidin-4-yl)-2-(hydroxymethyl)phenyl]-6-cyclopropyl-3-(1-prop-2-enoylazetidin-3-yl)isoquinolin-1-one (PubChem CID 130249609) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[3-(6-aminopyrimidin-4-yl)-2-(hydroxymethyl)phenyl]-6-cyclopropyl-3-(1-prop-2-enoylazetidin-3-yl)isoquinolin-1-one.
| Compound Name | 2-[3-(6-aminopyrimidin-4-yl)-2-(hydroxymethyl)phenyl]-6-cyclopropyl-3-(1-prop-2-enoylazetidin-3-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 130249609 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-[3-(6-aminopyrimidin-4-yl)-2-(hydroxymethyl)phenyl]-6-cyclopropyl-3-(1-prop-2-enoylazetidin-3-yl)isoquinolin-1-one |
| SMILES | C=CC(=O)N1CC(c2cc3cc(C4CC4)ccc3c(=O)n2-c2cccc(-c3cc(N)ncn3)c2CO)C1 |
| InChI | InChI=1S/C29H27N5O3/c1-2-28(36)33-13-20(14-33)26-11-19-10-18(17-6-7-17)8-9-21(19)29(37)34(26)25-5-3-4-22(23(25)15-35)24-12-27(30)32-16-31-24/h2-5,8-12,16-17,20,35H,1,6-7,13-15H2,(H2,30,31,32) |
| InChIKey | AZSYXSMTLJHJNI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|