About [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane
[[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane (PubChem CID 13025015) has the molecular formula C11H32IN2PSi3
and a molecular weight of 434.53 g/mol. Its IUPAC name is [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane.
Molecular Properties
| Compound Name | [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane |
| PubChem CID | 13025015 |
| Molecular Formula | C11H32IN2PSi3 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane |
| SMILES | CCP(I)(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H32IN2PSi3/c1-11-15(12,13-16(2,3)4)14(17(5,6)7)18(8,9)10/h11H2,1-10H3 |
| InChIKey | PLAHLWXRNSFQGL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane?
The IUPAC name of [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane (CID 13025015) is [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane.
What is the SMILES notation for [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane?
The canonical SMILES for [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane is CCP(I)(=N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane?
The InChIKey is PLAHLWXRNSFQGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H32IN2PSi3/c1-11-15(12,13-16(2,3)4)14(17(5,6)7)18(8,9)10/h11H2,1-10H3.
What are the key properties of [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane?
[[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane has a molecular weight of 434.53 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[bis(trimethylsilyl)amino]-iodo-trimethylsilylimino-λ5-phosphanyl]ethane is sourced from PubChem (CID 13025015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).