C14H14FN3 — CID 130250600
(2E,3E)-5-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-2-ethylidene-4-fluorohexa-3,5-dienenitrile (PubChem CID 130250600) has the molecular formula C14H14FN3 and a molecular weight of 243.28 g/mol. Its IUPAC name is (2E,3E)-5-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-2-ethylidene-4-fluorohexa-3,5-dienenitrile.
| Compound Name | (2E,3E)-5-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-2-ethylidene-4-fluorohexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 130250600 |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (2E,3E)-5-[(5R)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-2-ethylidene-4-fluorohexa-3,5-dienenitrile |
| SMILES | C=C(/C(F)=C\C(C#N)=C/C)[C@H]1CCc2cncn21 |
| InChI | InChI=1S/C14H14FN3/c1-3-11(7-16)6-13(15)10(2)14-5-4-12-8-17-9-18(12)14/h3,6,8-9,14H,2,4-5H2,1H3/b11-3+,13-6+/t14-/m1/s1 |
| InChIKey | SUHLQQGMJPYYEF-NEASVPFDSA-N |
| XLogP | 3.25 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|