About 5-methylimidazo[1,5-c]pyrimidine
5-methylimidazo[1,5-c]pyrimidine (PubChem CID 130250786) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 5-methylimidazo[1,5-c]pyrimidine.
Molecular Properties
| Compound Name | 5-methylimidazo[1,5-c]pyrimidine |
| PubChem CID | 130250786 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 5-methylimidazo[1,5-c]pyrimidine |
| SMILES | Cc1nccc2cncn12 |
| InChI | InChI=1S/C7H7N3/c1-6-9-3-2-7-4-8-5-10(6)7/h2-5H,1H3 |
| InChIKey | QDKGIEPCVSYMSM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylimidazo[1,5-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylimidazo[1,5-c]pyrimidine?
The IUPAC name of 5-methylimidazo[1,5-c]pyrimidine (CID 130250786) is 5-methylimidazo[1,5-c]pyrimidine.
What is the SMILES notation for 5-methylimidazo[1,5-c]pyrimidine?
The canonical SMILES for 5-methylimidazo[1,5-c]pyrimidine is Cc1nccc2cncn12.
What is the InChIKey of 5-methylimidazo[1,5-c]pyrimidine?
The InChIKey is QDKGIEPCVSYMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-6-9-3-2-7-4-8-5-10(6)7/h2-5H,1H3.
What are the key properties of 5-methylimidazo[1,5-c]pyrimidine?
5-methylimidazo[1,5-c]pyrimidine has a molecular weight of 133.15 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylimidazo[1,5-c]pyrimidine is sourced from PubChem (CID 130250786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).